C14H10NOY- — CID 59968233
2-methanidyl-5-phenyl-1,3-benzoxazole;yttrium (PubChem CID 59968233) has the molecular formula C14H10NOY- and a molecular weight of 297.15 g/mol. Its IUPAC name is 2-methanidyl-5-phenyl-1,3-benzoxazole;yttrium.
| Compound Name | 2-methanidyl-5-phenyl-1,3-benzoxazole;yttrium |
|---|---|
| PubChem CID | 59968233 |
| Molecular Formula | C14H10NOY- |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 2-methanidyl-5-phenyl-1,3-benzoxazole;yttrium |
| SMILES | [CH2-]c1nc2cc(-c3ccccc3)ccc2o1.[Y] |
| InChI | InChI=1S/C14H10NO.Y/c1-10-15-13-9-12(7-8-14(13)16-10)11-5-3-2-4-6-11;/h2-9H,1H2;/q-1; |
| InChIKey | LUVBEJSMLVEYRP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|