C18H18N2O — CID 102300837
5-phenyl-2-piperidin-1-yl-1,3-benzoxazole (PubChem CID 102300837) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is 5-phenyl-2-piperidin-1-yl-1,3-benzoxazole.
| Compound Name | 5-phenyl-2-piperidin-1-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 102300837 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 5-phenyl-2-piperidin-1-yl-1,3-benzoxazole |
| SMILES | c1ccc(-c2ccc3oc(N4CCCCC4)nc3c2)cc1 |
| InChI | InChI=1S/C18H18N2O/c1-3-7-14(8-4-1)15-9-10-17-16(13-15)19-18(21-17)20-11-5-2-6-12-20/h1,3-4,7-10,13H,2,5-6,11-12H2 |
| InChIKey | BOMKOSBSTSYFIC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |