C13H13N3O — CID 141046607
2-piperidin-1-yl-1,3-benzoxazole-5-carbonitrile (PubChem CID 141046607) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is 2-piperidin-1-yl-1,3-benzoxazole-5-carbonitrile.
| Compound Name | 2-piperidin-1-yl-1,3-benzoxazole-5-carbonitrile |
|---|---|
| PubChem CID | 141046607 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-piperidin-1-yl-1,3-benzoxazole-5-carbonitrile |
| SMILES | N#Cc1ccc2oc(N3CCCCC3)nc2c1 |
| InChI | InChI=1S/C13H13N3O/c14-9-10-4-5-12-11(8-10)15-13(17-12)16-6-2-1-3-7-16/h4-5,8H,1-3,6-7H2 |
| InChIKey | YPGRPOXTTNXVAK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 53.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |