C13H17N3O — CID 79891137
2-(azepan-1-yl)-1,3-benzoxazol-6-amine (PubChem CID 79891137) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-(azepan-1-yl)-1,3-benzoxazol-6-amine.
| Compound Name | 2-(azepan-1-yl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 79891137 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 2-(azepan-1-yl)-1,3-benzoxazol-6-amine |
| SMILES | Nc1ccc2nc(N3CCCCCC3)oc2c1 |
| InChI | InChI=1S/C13H17N3O/c14-10-5-6-11-12(9-10)17-13(15-11)16-7-3-1-2-4-8-16/h5-6,9H,1-4,7-8,14H2 |
| InChIKey | OJLFRPUMTRAXLL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|