C16H15N3O — CID 79881637
2-(3,4-dihydro-2H-quinolin-1-yl)-1,3-benzoxazol-6-amine (PubChem CID 79881637) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-quinolin-1-yl)-1,3-benzoxazol-6-amine.
| Compound Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 79881637 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-1,3-benzoxazol-6-amine |
| SMILES | Nc1ccc2nc(N3CCCc4ccccc43)oc2c1 |
| InChI | InChI=1S/C16H15N3O/c17-12-7-8-13-15(10-12)20-16(18-13)19-9-3-5-11-4-1-2-6-14(11)19/h1-2,4,6-8,10H,3,5,9,17H2 |
| InChIKey | PFCZLYGJYIDJOH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|