C16H12N4O — CID 79883039
2-(4-phenylpyrazol-1-yl)-1,3-benzoxazol-6-amine (PubChem CID 79883039) has the molecular formula C16H12N4O and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-(4-phenylpyrazol-1-yl)-1,3-benzoxazol-6-amine.
| Compound Name | 2-(4-phenylpyrazol-1-yl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 79883039 |
| Molecular Formula | C16H12N4O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-(4-phenylpyrazol-1-yl)-1,3-benzoxazol-6-amine |
| SMILES | Nc1ccc2nc(-n3cc(-c4ccccc4)cn3)oc2c1 |
| InChI | InChI=1S/C16H12N4O/c17-13-6-7-14-15(8-13)21-16(19-14)20-10-12(9-18-20)11-4-2-1-3-5-11/h1-10H,17H2 |
| InChIKey | SYFXJBJBNQKZLL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|