C10H8N4O — CID 61174865
1-(1,3-benzoxazol-2-yl)pyrazol-4-amine (PubChem CID 61174865) has the molecular formula C10H8N4O and a molecular weight of 200.20 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)pyrazol-4-amine.
| Compound Name | 1-(1,3-benzoxazol-2-yl)pyrazol-4-amine |
|---|---|
| PubChem CID | 61174865 |
| Molecular Formula | C10H8N4O |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)pyrazol-4-amine |
| SMILES | Nc1cnn(-c2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C10H8N4O/c11-7-5-12-14(6-7)10-13-8-3-1-2-4-9(8)15-10/h1-6H,11H2 |
| InChIKey | NTVORUCJMRQQOM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |