C14H8N2O2S — CID 4206564
3-(1,3-benzoxazol-2-yl)-1,3-benzoxazole-2-thione (PubChem CID 4206564) has the molecular formula C14H8N2O2S and a molecular weight of 268.30 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-1,3-benzoxazole-2-thione.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-1,3-benzoxazole-2-thione |
|---|---|
| PubChem CID | 4206564 |
| Molecular Formula | C14H8N2O2S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-1,3-benzoxazole-2-thione |
| SMILES | S=c1oc2ccccc2n1-c1nc2ccccc2o1 |
| InChI | InChI=1S/C14H8N2O2S/c19-14-16(10-6-2-4-8-12(10)18-14)13-15-9-5-1-3-7-11(9)17-13/h1-8H |
| InChIKey | NWVKOFXDZBMBRJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|