C15H9N3O3 — CID 175983951
1-(1,3-benzoxazol-2-yl)quinazoline-2,4-dione (PubChem CID 175983951) has the molecular formula C15H9N3O3 and a molecular weight of 279.25 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)quinazoline-2,4-dione.
| Compound Name | 1-(1,3-benzoxazol-2-yl)quinazoline-2,4-dione |
|---|---|
| PubChem CID | 175983951 |
| Molecular Formula | C15H9N3O3 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)quinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2nc3ccccc3o2)c2ccccc12 |
| InChI | InChI=1S/C15H9N3O3/c19-13-9-5-1-3-7-11(9)18(14(20)17-13)15-16-10-6-2-4-8-12(10)21-15/h1-8H,(H,17,19,20) |
| InChIKey | FSEPVWLLWALULH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |