C10H7ClN4O — CID 79890978
2-(4-chloropyrazol-1-yl)-1,3-benzoxazol-5-amine (PubChem CID 79890978) has the molecular formula C10H7ClN4O and a molecular weight of 234.65 g/mol. Its IUPAC name is 2-(4-chloropyrazol-1-yl)-1,3-benzoxazol-5-amine.
| Compound Name | 2-(4-chloropyrazol-1-yl)-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 79890978 |
| Molecular Formula | C10H7ClN4O |
| Molecular Weight | 234.65 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 2-(4-chloropyrazol-1-yl)-1,3-benzoxazol-5-amine |
| SMILES | Nc1ccc2oc(-n3cc(Cl)cn3)nc2c1 |
| InChI | InChI=1S/C10H7ClN4O/c11-6-4-13-15(5-6)10-14-8-3-7(12)1-2-9(8)16-10/h1-5H,12H2 |
| InChIKey | ONJGQZUQYFILTP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.65 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|