C14H19N3O — CID 79890886
2-(4,4-dimethylpiperidin-1-yl)-1,3-benzoxazol-5-amine (PubChem CID 79890886) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 2-(4,4-dimethylpiperidin-1-yl)-1,3-benzoxazol-5-amine.
| Compound Name | 2-(4,4-dimethylpiperidin-1-yl)-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 79890886 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 2-(4,4-dimethylpiperidin-1-yl)-1,3-benzoxazol-5-amine |
| SMILES | CC1(C)CCN(c2nc3cc(N)ccc3o2)CC1 |
| InChI | InChI=1S/C14H19N3O/c1-14(2)5-7-17(8-6-14)13-16-11-9-10(15)3-4-12(11)18-13/h3-4,9H,5-8,15H2,1-2H3 |
| InChIKey | SBMNYKISCCMRSV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|