About 2-(2,5-dimethylpiperidin-1-yl)-1,3-benzoxazol-5-amine
2-(2,5-dimethylpiperidin-1-yl)-1,3-benzoxazol-5-amine (PubChem CID 79890523) has the molecular formula C14H19N3O
and a molecular weight of 245.33 g/mol. Its IUPAC name is 2-(2,5-dimethylpiperidin-1-yl)-1,3-benzoxazol-5-amine.
Molecular Properties
| Compound Name | 2-(2,5-dimethylpiperidin-1-yl)-1,3-benzoxazol-5-amine |
| PubChem CID | 79890523 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 2-(2,5-dimethylpiperidin-1-yl)-1,3-benzoxazol-5-amine |
| SMILES | CC1CCC(C)N(c2nc3cc(N)ccc3o2)C1 |
| InChI | InChI=1S/C14H19N3O/c1-9-3-4-10(2)17(8-9)14-16-12-7-11(15)5-6-13(12)18-14/h5-7,9-10H,3-4,8,15H2,1-2H3 |
| InChIKey | VZRHEBWSUGDLJD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dimethylpiperidin-1-yl)-1,3-benzoxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethylpiperidin-1-yl)-1,3-benzoxazol-5-amine?
The IUPAC name of 2-(2,5-dimethylpiperidin-1-yl)-1,3-benzoxazol-5-amine (CID 79890523) is 2-(2,5-dimethylpiperidin-1-yl)-1,3-benzoxazol-5-amine.
What is the SMILES notation for 2-(2,5-dimethylpiperidin-1-yl)-1,3-benzoxazol-5-amine?
The canonical SMILES for 2-(2,5-dimethylpiperidin-1-yl)-1,3-benzoxazol-5-amine is CC1CCC(C)N(c2nc3cc(N)ccc3o2)C1.
What is the InChIKey of 2-(2,5-dimethylpiperidin-1-yl)-1,3-benzoxazol-5-amine?
The InChIKey is VZRHEBWSUGDLJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O/c1-9-3-4-10(2)17(8-9)14-16-12-7-11(15)5-6-13(12)18-14/h5-7,9-10H,3-4,8,15H2,1-2H3.
What are the key properties of 2-(2,5-dimethylpiperidin-1-yl)-1,3-benzoxazol-5-amine?
2-(2,5-dimethylpiperidin-1-yl)-1,3-benzoxazol-5-amine has a molecular weight of 245.33 g/mol, XLogP of 3.03, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylpiperidin-1-yl)-1,3-benzoxazol-5-amine is sourced from PubChem (CID 79890523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).