C9H16N4O — CID 103437132
5-(2,5-dimethylpiperidin-1-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 103437132) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 5-(2,5-dimethylpiperidin-1-yl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(2,5-dimethylpiperidin-1-yl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 103437132 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 5-(2,5-dimethylpiperidin-1-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | CC1CCC(C)N(c2nnc(N)o2)C1 |
| InChI | InChI=1S/C9H16N4O/c1-6-3-4-7(2)13(5-6)9-12-11-8(10)14-9/h6-7H,3-5H2,1-2H3,(H2,10,11) |
| InChIKey | AOFRTRPIQPRMJY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |