About 5-(3-methoxypyrrolidin-1-yl)-1,3,4-oxadiazol-2-amine
5-(3-methoxypyrrolidin-1-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 103542519) has the molecular formula C7H12N4O2
and a molecular weight of 184.20 g/mol. Its IUPAC name is 5-(3-methoxypyrrolidin-1-yl)-1,3,4-oxadiazol-2-amine.
Molecular Properties
| Compound Name | 5-(3-methoxypyrrolidin-1-yl)-1,3,4-oxadiazol-2-amine |
| PubChem CID | 103542519 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 5-(3-methoxypyrrolidin-1-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | COC1CCN(c2nnc(N)o2)C1 |
| InChI | InChI=1S/C7H12N4O2/c1-12-5-2-3-11(4-5)7-10-9-6(8)13-7/h5H,2-4H2,1H3,(H2,8,9) |
| InChIKey | ZBEWREZHLCLQJW-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(3-methoxypyrrolidin-1-yl)-1,3,4-oxadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methoxypyrrolidin-1-yl)-1,3,4-oxadiazol-2-amine?
The IUPAC name of 5-(3-methoxypyrrolidin-1-yl)-1,3,4-oxadiazol-2-amine (CID 103542519) is 5-(3-methoxypyrrolidin-1-yl)-1,3,4-oxadiazol-2-amine.
What is the SMILES notation for 5-(3-methoxypyrrolidin-1-yl)-1,3,4-oxadiazol-2-amine?
The canonical SMILES for 5-(3-methoxypyrrolidin-1-yl)-1,3,4-oxadiazol-2-amine is COC1CCN(c2nnc(N)o2)C1.
What is the InChIKey of 5-(3-methoxypyrrolidin-1-yl)-1,3,4-oxadiazol-2-amine?
The InChIKey is ZBEWREZHLCLQJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O2/c1-12-5-2-3-11(4-5)7-10-9-6(8)13-7/h5H,2-4H2,1H3,(H2,8,9).
What are the key properties of 5-(3-methoxypyrrolidin-1-yl)-1,3,4-oxadiazol-2-amine?
5-(3-methoxypyrrolidin-1-yl)-1,3,4-oxadiazol-2-amine has a molecular weight of 184.20 g/mol, XLogP of -0.12, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methoxypyrrolidin-1-yl)-1,3,4-oxadiazol-2-amine is sourced from PubChem (CID 103542519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).