C8H13N3OS — CID 102547220
2-(3-methoxypyrrolidin-1-yl)-1,3-thiazol-4-amine (PubChem CID 102547220) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is 2-(3-methoxypyrrolidin-1-yl)-1,3-thiazol-4-amine.
| Compound Name | 2-(3-methoxypyrrolidin-1-yl)-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 102547220 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-(3-methoxypyrrolidin-1-yl)-1,3-thiazol-4-amine |
| SMILES | COC1CCN(c2nc(N)cs2)C1 |
| InChI | InChI=1S/C8H13N3OS/c1-12-6-2-3-11(4-6)8-10-7(9)5-13-8/h5-6H,2-4,9H2,1H3 |
| InChIKey | BYACMRSTELWUOS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |