About 2-(3-methoxypyrrolidin-1-yl)-1,3-thiazol-4-amine
2-(3-methoxypyrrolidin-1-yl)-1,3-thiazol-4-amine (PubChem CID 102547220) has the molecular formula C8H13N3OS
and a molecular weight of 199.28 g/mol. Its IUPAC name is 2-(3-methoxypyrrolidin-1-yl)-1,3-thiazol-4-amine.
Molecular Properties
| Compound Name | 2-(3-methoxypyrrolidin-1-yl)-1,3-thiazol-4-amine |
| PubChem CID | 102547220 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-(3-methoxypyrrolidin-1-yl)-1,3-thiazol-4-amine |
| SMILES | COC1CCN(c2nc(N)cs2)C1 |
| InChI | InChI=1S/C8H13N3OS/c1-12-6-2-3-11(4-6)8-10-7(9)5-13-8/h5-6H,2-4,9H2,1H3 |
| InChIKey | BYACMRSTELWUOS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-methoxypyrrolidin-1-yl)-1,3-thiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methoxypyrrolidin-1-yl)-1,3-thiazol-4-amine?
The IUPAC name of 2-(3-methoxypyrrolidin-1-yl)-1,3-thiazol-4-amine (CID 102547220) is 2-(3-methoxypyrrolidin-1-yl)-1,3-thiazol-4-amine.
What is the SMILES notation for 2-(3-methoxypyrrolidin-1-yl)-1,3-thiazol-4-amine?
The canonical SMILES for 2-(3-methoxypyrrolidin-1-yl)-1,3-thiazol-4-amine is COC1CCN(c2nc(N)cs2)C1.
What is the InChIKey of 2-(3-methoxypyrrolidin-1-yl)-1,3-thiazol-4-amine?
The InChIKey is BYACMRSTELWUOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3OS/c1-12-6-2-3-11(4-6)8-10-7(9)5-13-8/h5-6H,2-4,9H2,1H3.
What are the key properties of 2-(3-methoxypyrrolidin-1-yl)-1,3-thiazol-4-amine?
2-(3-methoxypyrrolidin-1-yl)-1,3-thiazol-4-amine has a molecular weight of 199.28 g/mol, XLogP of 0.95, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxypyrrolidin-1-yl)-1,3-thiazol-4-amine is sourced from PubChem (CID 102547220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).