C10H14N2O2S — CID 89222120
2-(4-methoxypiperidin-1-yl)-1,3-thiazole-4-carbaldehyde (PubChem CID 89222120) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-(4-methoxypiperidin-1-yl)-1,3-thiazole-4-carbaldehyde.
| Compound Name | 2-(4-methoxypiperidin-1-yl)-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 89222120 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-(4-methoxypiperidin-1-yl)-1,3-thiazole-4-carbaldehyde |
| SMILES | COC1CCN(c2nc(C=O)cs2)CC1 |
| InChI | InChI=1S/C10H14N2O2S/c1-14-9-2-4-12(5-3-9)10-11-8(6-13)7-15-10/h6-7,9H,2-5H2,1H3 |
| InChIKey | JXKCNSZKXDVKCS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|