C9H14N4O — CID 103541702
6-(3-methoxypyrrolidin-1-yl)pyrazin-2-amine (PubChem CID 103541702) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 6-(3-methoxypyrrolidin-1-yl)pyrazin-2-amine.
| Compound Name | 6-(3-methoxypyrrolidin-1-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 103541702 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 6-(3-methoxypyrrolidin-1-yl)pyrazin-2-amine |
| SMILES | COC1CCN(c2cncc(N)n2)C1 |
| InChI | InChI=1S/C9H14N4O/c1-14-7-2-3-13(6-7)9-5-11-4-8(10)12-9/h4-5,7H,2-3,6H2,1H3,(H2,10,12) |
| InChIKey | GPAXYMAPOWMYAZ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |