C10H17N5O — CID 80895399
[6-(4-methoxypiperidin-1-yl)pyrazin-2-yl]hydrazine (PubChem CID 80895399) has the molecular formula C10H17N5O and a molecular weight of 223.28 g/mol. Its IUPAC name is [6-(4-methoxypiperidin-1-yl)pyrazin-2-yl]hydrazine.
| Compound Name | [6-(4-methoxypiperidin-1-yl)pyrazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80895399 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | [6-(4-methoxypiperidin-1-yl)pyrazin-2-yl]hydrazine |
| SMILES | COC1CCN(c2cncc(NN)n2)CC1 |
| InChI | InChI=1S/C10H17N5O/c1-16-8-2-4-15(5-3-8)10-7-12-6-9(13-10)14-11/h6-8H,2-5,11H2,1H3,(H,13,14) |
| InChIKey | GLXLNGGVWYJIRI-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|