C11H17N5 — CID 115563138
[6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)pyrazin-2-yl]hydrazine (PubChem CID 115563138) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is [6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)pyrazin-2-yl]hydrazine.
| Compound Name | [6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)pyrazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 115563138 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | [6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)pyrazin-2-yl]hydrazine |
| SMILES | NNc1cncc(N2CC3CCCC3C2)n1 |
| InChI | InChI=1S/C11H17N5/c12-15-10-4-13-5-11(14-10)16-6-8-2-1-3-9(8)7-16/h4-5,8-9H,1-3,6-7,12H2,(H,14,15) |
| InChIKey | OIWCQKWYSCOQEI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|