C12H19N5 — CID 82755530
[6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)pyrazin-2-yl]hydrazine (PubChem CID 82755530) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is [6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)pyrazin-2-yl]hydrazine.
| Compound Name | [6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)pyrazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 82755530 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | [6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)pyrazin-2-yl]hydrazine |
| SMILES | NNc1cncc(N2CCC3CCCCC32)n1 |
| InChI | InChI=1S/C12H19N5/c13-16-11-7-14-8-12(15-11)17-6-5-9-3-1-2-4-10(9)17/h7-10H,1-6,13H2,(H,15,16) |
| InChIKey | XZGCJGPCDVTNII-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|