About 6-(2,5-dimethylpiperidin-1-yl)pyridine-2,3-diamine
6-(2,5-dimethylpiperidin-1-yl)pyridine-2,3-diamine (PubChem CID 79826265) has the molecular formula C12H20N4
and a molecular weight of 220.32 g/mol. Its IUPAC name is 6-(2,5-dimethylpiperidin-1-yl)pyridine-2,3-diamine.
Molecular Properties
| Compound Name | 6-(2,5-dimethylpiperidin-1-yl)pyridine-2,3-diamine |
| PubChem CID | 79826265 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 6-(2,5-dimethylpiperidin-1-yl)pyridine-2,3-diamine |
| SMILES | CC1CCC(C)N(c2ccc(N)c(N)n2)C1 |
| InChI | InChI=1S/C12H20N4/c1-8-3-4-9(2)16(7-8)11-6-5-10(13)12(14)15-11/h5-6,8-9H,3-4,7,13H2,1-2H3,(H2,14,15) |
| InChIKey | VZFMJSDANHVAHQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2,5-dimethylpiperidin-1-yl)pyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,5-dimethylpiperidin-1-yl)pyridine-2,3-diamine?
The IUPAC name of 6-(2,5-dimethylpiperidin-1-yl)pyridine-2,3-diamine (CID 79826265) is 6-(2,5-dimethylpiperidin-1-yl)pyridine-2,3-diamine.
What is the SMILES notation for 6-(2,5-dimethylpiperidin-1-yl)pyridine-2,3-diamine?
The canonical SMILES for 6-(2,5-dimethylpiperidin-1-yl)pyridine-2,3-diamine is CC1CCC(C)N(c2ccc(N)c(N)n2)C1.
What is the InChIKey of 6-(2,5-dimethylpiperidin-1-yl)pyridine-2,3-diamine?
The InChIKey is VZFMJSDANHVAHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4/c1-8-3-4-9(2)16(7-8)11-6-5-10(13)12(14)15-11/h5-6,8-9H,3-4,7,13H2,1-2H3,(H2,14,15).
What are the key properties of 6-(2,5-dimethylpiperidin-1-yl)pyridine-2,3-diamine?
6-(2,5-dimethylpiperidin-1-yl)pyridine-2,3-diamine has a molecular weight of 220.32 g/mol, XLogP of 1.87, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-dimethylpiperidin-1-yl)pyridine-2,3-diamine is sourced from PubChem (CID 79826265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).