C10H16N4O — CID 79826016
6-(3-methylmorpholin-4-yl)pyridine-2,3-diamine (PubChem CID 79826016) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 6-(3-methylmorpholin-4-yl)pyridine-2,3-diamine.
| Compound Name | 6-(3-methylmorpholin-4-yl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 79826016 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 6-(3-methylmorpholin-4-yl)pyridine-2,3-diamine |
| SMILES | CC1COCCN1c1ccc(N)c(N)n1 |
| InChI | InChI=1S/C10H16N4O/c1-7-6-15-5-4-14(7)9-3-2-8(11)10(12)13-9/h2-3,7H,4-6,11H2,1H3,(H2,12,13) |
| InChIKey | SHBJMGADEKLHTB-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |