C13H21N3 — CID 81132345
2-(2,5-dimethylpiperidin-1-yl)-6-methylpyridin-3-amine (PubChem CID 81132345) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-(2,5-dimethylpiperidin-1-yl)-6-methylpyridin-3-amine.
| Compound Name | 2-(2,5-dimethylpiperidin-1-yl)-6-methylpyridin-3-amine |
|---|---|
| PubChem CID | 81132345 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 2-(2,5-dimethylpiperidin-1-yl)-6-methylpyridin-3-amine |
| SMILES | Cc1ccc(N)c(N2CC(C)CCC2C)n1 |
| InChI | InChI=1S/C13H21N3/c1-9-4-6-11(3)16(8-9)13-12(14)7-5-10(2)15-13/h5,7,9,11H,4,6,8,14H2,1-3H3 |
| InChIKey | BVFIFJPHXMWEMF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |