C10H13N5O2 — CID 79827948
4-(5,6-diamino-2-pyridinyl)-3-methylpiperazine-2,6-dione (PubChem CID 79827948) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is 4-(5,6-diamino-2-pyridinyl)-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(5,6-diamino-2-pyridinyl)-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 79827948 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 4-(5,6-diamino-2-pyridinyl)-3-methylpiperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1c1ccc(N)c(N)n1 |
| InChI | InChI=1S/C10H13N5O2/c1-5-10(17)14-8(16)4-15(5)7-3-2-6(11)9(12)13-7/h2-3,5H,4,11H2,1H3,(H2,12,13)(H,14,16,17) |
| InChIKey | HNWQSEHVZNYXMR-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|