C13H18N4O3 — CID 66069258
4-(5-amino-6-ethoxy-2-pyridinyl)-3-ethylpiperazine-2,6-dione (PubChem CID 66069258) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 4-(5-amino-6-ethoxy-2-pyridinyl)-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-(5-amino-6-ethoxy-2-pyridinyl)-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66069258 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 4-(5-amino-6-ethoxy-2-pyridinyl)-3-ethylpiperazine-2,6-dione |
| SMILES | CCOc1nc(N2CC(=O)NC(=O)C2CC)ccc1N |
| InChI | InChI=1S/C13H18N4O3/c1-3-9-12(19)16-11(18)7-17(9)10-6-5-8(14)13(15-10)20-4-2/h5-6,9H,3-4,7,14H2,1-2H3,(H,16,18,19) |
| InChIKey | RVELTUUMXMFOEE-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|