C11H17N7O3 — CID 80925206
4-(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)-3-ethylpiperazine-2,6-dione (PubChem CID 80925206) has the molecular formula C11H17N7O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is 4-(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 80925206 |
| Molecular Formula | C11H17N7O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 4-(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)-3-ethylpiperazine-2,6-dione |
| SMILES | CCOc1nc(NN)nc(N2CC(=O)NC(=O)C2CC)n1 |
| InChI | InChI=1S/C11H17N7O3/c1-3-6-8(20)13-7(19)5-18(6)10-14-9(17-12)15-11(16-10)21-4-2/h6H,3-5,12H2,1-2H3,(H,13,19,20)(H,14,15,16,17) |
| InChIKey | JFUADMMCGPLDCH-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 135.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|