C10H18N6O — CID 80899195
[4-ethoxy-6-(3-methylpyrrolidin-1-yl)-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80899195) has the molecular formula C10H18N6O and a molecular weight of 238.29 g/mol. Its IUPAC name is [4-ethoxy-6-(3-methylpyrrolidin-1-yl)-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-ethoxy-6-(3-methylpyrrolidin-1-yl)-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80899195 |
| Molecular Formula | C10H18N6O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | [4-ethoxy-6-(3-methylpyrrolidin-1-yl)-1,3,5-triazin-2-yl]hydrazine |
| SMILES | CCOc1nc(NN)nc(N2CCC(C)C2)n1 |
| InChI | InChI=1S/C10H18N6O/c1-3-17-10-13-8(15-11)12-9(14-10)16-5-4-7(2)6-16/h7H,3-6,11H2,1-2H3,(H,12,13,14,15) |
| InChIKey | YIYSYLNKJLLCMI-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|