C10H18N6O3 — CID 81218495
[4-(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)morpholin-2-yl]methanol (PubChem CID 81218495) has the molecular formula C10H18N6O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is [4-(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)morpholin-2-yl]methanol.
| Compound Name | [4-(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 81218495 |
| Molecular Formula | C10H18N6O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | [4-(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)morpholin-2-yl]methanol |
| SMILES | CCOc1nc(NN)nc(N2CCOC(CO)C2)n1 |
| InChI | InChI=1S/C10H18N6O3/c1-2-18-10-13-8(15-11)12-9(14-10)16-3-4-19-7(5-16)6-17/h7,17H,2-6,11H2,1H3,(H,12,13,14,15) |
| InChIKey | PEUUFXNRVUAQLZ-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|