C12H23N7O — CID 80911156
[4-ethoxy-6-(4-ethyl-3-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80911156) has the molecular formula C12H23N7O and a molecular weight of 281.36 g/mol. Its IUPAC name is [4-ethoxy-6-(4-ethyl-3-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-ethoxy-6-(4-ethyl-3-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80911156 |
| Molecular Formula | C12H23N7O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | [4-ethoxy-6-(4-ethyl-3-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]hydrazine |
| SMILES | CCOc1nc(NN)nc(N2CCN(CC)C(C)C2)n1 |
| InChI | InChI=1S/C12H23N7O/c1-4-18-6-7-19(8-9(18)3)11-14-10(17-13)15-12(16-11)20-5-2/h9H,4-8,13H2,1-3H3,(H,14,15,16,17) |
| InChIKey | HBLFDTNRAZGGLU-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|