C9H16N6O2 — CID 112629745
[1-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)pyrrolidin-3-yl]methanol (PubChem CID 112629745) has the molecular formula C9H16N6O2 and a molecular weight of 240.27 g/mol. Its IUPAC name is [1-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)pyrrolidin-3-yl]methanol.
| Compound Name | [1-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 112629745 |
| Molecular Formula | C9H16N6O2 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | [1-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)pyrrolidin-3-yl]methanol |
| SMILES | COc1nc(NN)nc(N2CCC(CO)C2)n1 |
| InChI | InChI=1S/C9H16N6O2/c1-17-9-12-7(14-10)11-8(13-9)15-3-2-6(4-15)5-16/h6,16H,2-5,10H2,1H3,(H,11,12,13,14) |
| InChIKey | MCWJWKNMWZKUJP-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|