C11H19N7O3 — CID 107877882
ethyl 4-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)piperazine-1-carboxylate (PubChem CID 107877882) has the molecular formula C11H19N7O3 and a molecular weight of 297.32 g/mol. Its IUPAC name is ethyl 4-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 107877882 |
| Molecular Formula | C11H19N7O3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | ethyl 4-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2nc(NN)nc(OC)n2)CC1 |
| InChI | InChI=1S/C11H19N7O3/c1-3-21-11(19)18-6-4-17(5-7-18)9-13-8(16-12)14-10(15-9)20-2/h3-7,12H2,1-2H3,(H,13,14,15,16) |
| InChIKey | NTPYWDWBWOUUKD-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 118.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|