About ethyl 4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperazine-1-carboxylate
ethyl 4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperazine-1-carboxylate (PubChem CID 107877533) has the molecular formula C12H18ClN5O3
and a molecular weight of 315.76 g/mol. Its IUPAC name is ethyl 4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperazine-1-carboxylate |
| PubChem CID | 107877533 |
| Molecular Formula | C12H18ClN5O3 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | ethyl 4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2nc(Cl)nc(OCC)n2)CC1 |
| InChI | InChI=1S/C12H18ClN5O3/c1-3-20-11-15-9(13)14-10(16-11)17-5-7-18(8-6-17)12(19)21-4-2/h3-8H2,1-2H3 |
| InChIKey | CCMZQZBLEKVYKA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 80.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperazine-1-carboxylate?
The IUPAC name of ethyl 4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperazine-1-carboxylate (CID 107877533) is ethyl 4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperazine-1-carboxylate is CCOC(=O)N1CCN(c2nc(Cl)nc(OCC)n2)CC1.
What is the InChIKey of ethyl 4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperazine-1-carboxylate?
The InChIKey is CCMZQZBLEKVYKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClN5O3/c1-3-20-11-15-9(13)14-10(16-11)17-5-7-18(8-6-17)12(19)21-4-2/h3-8H2,1-2H3.
What are the key properties of ethyl 4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperazine-1-carboxylate?
ethyl 4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperazine-1-carboxylate has a molecular weight of 315.76 g/mol, XLogP of 1.20, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperazine-1-carboxylate is sourced from PubChem (CID 107877533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).