C12H19ClN4O — CID 62869524
1-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)azepane (PubChem CID 62869524) has the molecular formula C12H19ClN4O and a molecular weight of 270.76 g/mol. Its IUPAC name is 1-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)azepane.
| Compound Name | 1-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)azepane |
|---|---|
| PubChem CID | 62869524 |
| Molecular Formula | C12H19ClN4O |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 1-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)azepane |
| SMILES | CCCOc1nc(Cl)nc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C12H19ClN4O/c1-2-9-18-12-15-10(13)14-11(16-12)17-7-5-3-4-6-8-17/h2-9H2,1H3 |
| InChIKey | UROHHAMJFQLYMH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |