C11H14ClF3N4O — CID 82789263
2-chloro-4-pyrrolidin-1-yl-6-(4,4,4-trifluorobutoxy)-1,3,5-triazine (PubChem CID 82789263) has the molecular formula C11H14ClF3N4O and a molecular weight of 310.71 g/mol. Its IUPAC name is 2-chloro-4-pyrrolidin-1-yl-6-(4,4,4-trifluorobutoxy)-1,3,5-triazine.
| Compound Name | 2-chloro-4-pyrrolidin-1-yl-6-(4,4,4-trifluorobutoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 82789263 |
| Molecular Formula | C11H14ClF3N4O |
| Molecular Weight | 310.71 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-chloro-4-pyrrolidin-1-yl-6-(4,4,4-trifluorobutoxy)-1,3,5-triazine |
| SMILES | FC(F)(F)CCCOc1nc(Cl)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C11H14ClF3N4O/c12-8-16-9(19-5-1-2-6-19)18-10(17-8)20-7-3-4-11(13,14)15/h1-7H2 |
| InChIKey | FSZWNDOPPJGNCW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.71 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|