C14H15ClN4O2 — CID 62868780
2-chloro-4-(4-methoxyphenoxy)-6-pyrrolidin-1-yl-1,3,5-triazine (PubChem CID 62868780) has the molecular formula C14H15ClN4O2 and a molecular weight of 306.75 g/mol. Its IUPAC name is 2-chloro-4-(4-methoxyphenoxy)-6-pyrrolidin-1-yl-1,3,5-triazine.
| Compound Name | 2-chloro-4-(4-methoxyphenoxy)-6-pyrrolidin-1-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 62868780 |
| Molecular Formula | C14H15ClN4O2 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-chloro-4-(4-methoxyphenoxy)-6-pyrrolidin-1-yl-1,3,5-triazine |
| SMILES | COc1ccc(Oc2nc(Cl)nc(N3CCCC3)n2)cc1 |
| InChI | InChI=1S/C14H15ClN4O2/c1-20-10-4-6-11(7-5-10)21-14-17-12(15)16-13(18-14)19-8-2-3-9-19/h4-7H,2-3,8-9H2,1H3 |
| InChIKey | SYGLBCVGTMLPEI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |