C13H11Br2ClN4O — CID 64719973
2-chloro-4-(2,4-dibromophenoxy)-6-pyrrolidin-1-yl-1,3,5-triazine (PubChem CID 64719973) has the molecular formula C13H11Br2ClN4O and a molecular weight of 434.52 g/mol. Its IUPAC name is 2-chloro-4-(2,4-dibromophenoxy)-6-pyrrolidin-1-yl-1,3,5-triazine.
| Compound Name | 2-chloro-4-(2,4-dibromophenoxy)-6-pyrrolidin-1-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 64719973 |
| Molecular Formula | C13H11Br2ClN4O |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 431.90 |
| IUPAC Name | 2-chloro-4-(2,4-dibromophenoxy)-6-pyrrolidin-1-yl-1,3,5-triazine |
| SMILES | Clc1nc(Oc2ccc(Br)cc2Br)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C13H11Br2ClN4O/c14-8-3-4-10(9(15)7-8)21-13-18-11(16)17-12(19-13)20-5-1-2-6-20/h3-4,7H,1-2,5-6H2 |
| InChIKey | YLGCLNIGUGAPFS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |