C11H4Br2Cl3NO — CID 102749707
2,3,5-trichloro-6-(2,4-dibromophenoxy)pyridine (PubChem CID 102749707) has the molecular formula C11H4Br2Cl3NO and a molecular weight of 432.33 g/mol. Its IUPAC name is 2,3,5-trichloro-6-(2,4-dibromophenoxy)pyridine.
| Compound Name | 2,3,5-trichloro-6-(2,4-dibromophenoxy)pyridine |
|---|---|
| PubChem CID | 102749707 |
| Molecular Formula | C11H4Br2Cl3NO |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 428.77 |
| IUPAC Name | 2,3,5-trichloro-6-(2,4-dibromophenoxy)pyridine |
| SMILES | Clc1cc(Cl)c(Oc2ccc(Br)cc2Br)nc1Cl |
| InChI | InChI=1S/C11H4Br2Cl3NO/c12-5-1-2-9(6(13)3-5)18-11-8(15)4-7(14)10(16)17-11/h1-4H |
| InChIKey | ZENNHVAHSZUZDI-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|