C15H7BrCl3NO — CID 102749474
2-(1-bromonaphthalen-2-yl)oxy-3,5,6-trichloropyridine (PubChem CID 102749474) has the molecular formula C15H7BrCl3NO and a molecular weight of 403.49 g/mol. Its IUPAC name is 2-(1-bromonaphthalen-2-yl)oxy-3,5,6-trichloropyridine.
| Compound Name | 2-(1-bromonaphthalen-2-yl)oxy-3,5,6-trichloropyridine |
|---|---|
| PubChem CID | 102749474 |
| Molecular Formula | C15H7BrCl3NO |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 400.88 |
| IUPAC Name | 2-(1-bromonaphthalen-2-yl)oxy-3,5,6-trichloropyridine |
| SMILES | Clc1cc(Cl)c(Oc2ccc3ccccc3c2Br)nc1Cl |
| InChI | InChI=1S/C15H7BrCl3NO/c16-13-9-4-2-1-3-8(9)5-6-12(13)21-15-11(18)7-10(17)14(19)20-15/h1-7H |
| InChIKey | STAAUOZQALVOJF-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|