C11H4BrCl3N2O3 — CID 102749806
2-(2-bromo-3-nitrophenoxy)-3,5,6-trichloropyridine (PubChem CID 102749806) has the molecular formula C11H4BrCl3N2O3 and a molecular weight of 398.43 g/mol. Its IUPAC name is 2-(2-bromo-3-nitrophenoxy)-3,5,6-trichloropyridine.
| Compound Name | 2-(2-bromo-3-nitrophenoxy)-3,5,6-trichloropyridine |
|---|---|
| PubChem CID | 102749806 |
| Molecular Formula | C11H4BrCl3N2O3 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 395.85 |
| IUPAC Name | 2-(2-bromo-3-nitrophenoxy)-3,5,6-trichloropyridine |
| SMILES | O=[N+]([O-])c1cccc(Oc2nc(Cl)c(Cl)cc2Cl)c1Br |
| InChI | InChI=1S/C11H4BrCl3N2O3/c12-9-7(17(18)19)2-1-3-8(9)20-11-6(14)4-5(13)10(15)16-11/h1-4H |
| InChIKey | UPLSFRTXNRDXHH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|