C10H4BrCl2N3O3 — CID 113497815
4-(2-bromo-3-nitrophenoxy)-2,5-dichloropyrimidine (PubChem CID 113497815) has the molecular formula C10H4BrCl2N3O3 and a molecular weight of 364.97 g/mol. Its IUPAC name is 4-(2-bromo-3-nitrophenoxy)-2,5-dichloropyrimidine.
| Compound Name | 4-(2-bromo-3-nitrophenoxy)-2,5-dichloropyrimidine |
|---|---|
| PubChem CID | 113497815 |
| Molecular Formula | C10H4BrCl2N3O3 |
| Molecular Weight | 364.97 g/mol |
| Exact Mass | 362.88 |
| IUPAC Name | 4-(2-bromo-3-nitrophenoxy)-2,5-dichloropyrimidine |
| SMILES | O=[N+]([O-])c1cccc(Oc2nc(Cl)ncc2Cl)c1Br |
| InChI | InChI=1S/C10H4BrCl2N3O3/c11-8-6(16(17)18)2-1-3-7(8)19-9-5(12)4-14-10(13)15-9/h1-4H |
| InChIKey | ZWPCKDYDNKHCHE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.97 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|