C12H11Cl2N2OP — CID 144987523
[2-(2,5-dichloropyrimidin-4-yl)oxyphenyl]-dimethylphosphane (PubChem CID 144987523) has the molecular formula C12H11Cl2N2OP and a molecular weight of 301.11 g/mol. Its IUPAC name is [2-(2,5-dichloropyrimidin-4-yl)oxyphenyl]-dimethylphosphane.
| Compound Name | [2-(2,5-dichloropyrimidin-4-yl)oxyphenyl]-dimethylphosphane |
|---|---|
| PubChem CID | 144987523 |
| Molecular Formula | C12H11Cl2N2OP |
| Molecular Weight | 301.11 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | [2-(2,5-dichloropyrimidin-4-yl)oxyphenyl]-dimethylphosphane |
| SMILES | CP(C)c1ccccc1Oc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C12H11Cl2N2OP/c1-18(2)10-6-4-3-5-9(10)17-11-8(13)7-15-12(14)16-11/h3-7H,1-2H3 |
| InChIKey | KNQKBXTXJFZBJV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.11 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|