C11H4Cl3FN2O3 — CID 102749797
2,3,5-trichloro-6-(2-fluoro-6-nitrophenoxy)pyridine (PubChem CID 102749797) has the molecular formula C11H4Cl3FN2O3 and a molecular weight of 337.52 g/mol. Its IUPAC name is 2,3,5-trichloro-6-(2-fluoro-6-nitrophenoxy)pyridine.
| Compound Name | 2,3,5-trichloro-6-(2-fluoro-6-nitrophenoxy)pyridine |
|---|---|
| PubChem CID | 102749797 |
| Molecular Formula | C11H4Cl3FN2O3 |
| Molecular Weight | 337.52 g/mol |
| Exact Mass | 335.93 |
| IUPAC Name | 2,3,5-trichloro-6-(2-fluoro-6-nitrophenoxy)pyridine |
| SMILES | O=[N+]([O-])c1cccc(F)c1Oc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H4Cl3FN2O3/c12-5-4-6(13)11(16-10(5)14)20-9-7(15)2-1-3-8(9)17(18)19/h1-4H |
| InChIKey | HTGQVZKQESKRCA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|