C20H11Cl3N8O5 — CID 15363627
2-N,4-N-bis(2-nitrophenyl)-6-[(3,5,6-trichloro-2-pyridinyl)oxy]-1,3,5-triazine-2,4-diamine (PubChem CID 15363627) has the molecular formula C20H11Cl3N8O5 and a molecular weight of 549.72 g/mol. Its IUPAC name is 2-N,4-N-bis(2-nitrophenyl)-6-[(3,5,6-trichloro-2-pyridinyl)oxy]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(2-nitrophenyl)-6-[(3,5,6-trichloro-2-pyridinyl)oxy]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 15363627 |
| Molecular Formula | C20H11Cl3N8O5 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 547.99 |
| IUPAC Name | 2-N,4-N-bis(2-nitrophenyl)-6-[(3,5,6-trichloro-2-pyridinyl)oxy]-1,3,5-triazine-2,4-diamine |
| SMILES | O=[N+]([O-])c1ccccc1Nc1nc(Nc2ccccc2[N+](=O)[O-])nc(Oc2nc(Cl)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C20H11Cl3N8O5/c21-10-9-11(22)17(26-16(10)23)36-20-28-18(24-12-5-1-3-7-14(12)30(32)33)27-19(29-20)25-13-6-2-4-8-15(13)31(34)35/h1-9H,(H2,24,25,27,28,29) |
| InChIKey | JJPSEYGMTLTBRM-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 171.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|