C24H17N9O7S — CID 155538785
3-[4,6-bis(2-nitroanilino)-1,3,5-triazin-2-yl]-2-(2-nitrophenyl)-1,3-thiazolidin-4-one (PubChem CID 155538785) has the molecular formula C24H17N9O7S and a molecular weight of 575.52 g/mol. Its IUPAC name is 3-[4,6-bis(2-nitroanilino)-1,3,5-triazin-2-yl]-2-(2-nitrophenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-[4,6-bis(2-nitroanilino)-1,3,5-triazin-2-yl]-2-(2-nitrophenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 155538785 |
| Molecular Formula | C24H17N9O7S |
| Molecular Weight | 575.52 g/mol |
| Exact Mass | 575.10 |
| IUPAC Name | 3-[4,6-bis(2-nitroanilino)-1,3,5-triazin-2-yl]-2-(2-nitrophenyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccccc2[N+](=O)[O-])N1c1nc(Nc2ccccc2[N+](=O)[O-])nc(Nc2ccccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C24H17N9O7S/c34-20-13-41-21(14-7-1-4-10-17(14)31(35)36)30(20)24-28-22(25-15-8-2-5-11-18(15)32(37)38)27-23(29-24)26-16-9-3-6-12-19(16)33(39)40/h1-12,21H,13H2,(H2,25,26,27,28,29) |
| InChIKey | TUMDSQKEAHXHHY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 212.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|