C15H14N4O3S — CID 134105118
3-(4,6-dimethylpyrimidin-2-yl)-2-(2-nitrophenyl)-1,3-thiazolidin-4-one (PubChem CID 134105118) has the molecular formula C15H14N4O3S and a molecular weight of 330.37 g/mol. Its IUPAC name is 3-(4,6-dimethylpyrimidin-2-yl)-2-(2-nitrophenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-(4,6-dimethylpyrimidin-2-yl)-2-(2-nitrophenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 134105118 |
| Molecular Formula | C15H14N4O3S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 3-(4,6-dimethylpyrimidin-2-yl)-2-(2-nitrophenyl)-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C)nc(N2C(=O)CSC2c2ccccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C15H14N4O3S/c1-9-7-10(2)17-15(16-9)18-13(20)8-23-14(18)11-5-3-4-6-12(11)19(21)22/h3-7,14H,8H2,1-2H3 |
| InChIKey | PZCJFABEVFTNTJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 89.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|