C23H18ClN3O5S — CID 46132828
4-chloro-N-[2-[3-(2-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-3-nitrobenzamide (PubChem CID 46132828) has the molecular formula C23H18ClN3O5S and a molecular weight of 483.93 g/mol. Its IUPAC name is 4-chloro-N-[2-[3-(2-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[2-[3-(2-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 46132828 |
| Molecular Formula | C23H18ClN3O5S |
| Molecular Weight | 483.93 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | 4-chloro-N-[2-[3-(2-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-3-nitrobenzamide |
| SMILES | COc1ccccc1N1C(=O)CSC1c1ccccc1NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H18ClN3O5S/c1-32-20-9-5-4-8-18(20)26-21(28)13-33-23(26)15-6-2-3-7-17(15)25-22(29)14-10-11-16(24)19(12-14)27(30)31/h2-12,23H,13H2,1H3,(H,25,29) |
| InChIKey | ODSNELWAMWGCLD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.93 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|