C21H13ClN2O8 — CID 18506214
4-[2-[(4-chloro-3-nitrobenzoyl)amino]phenoxy]phthalic acid (PubChem CID 18506214) has the molecular formula C21H13ClN2O8 and a molecular weight of 456.79 g/mol. Its IUPAC name is 4-[2-[(4-chloro-3-nitrobenzoyl)amino]phenoxy]phthalic acid.
| Compound Name | 4-[2-[(4-chloro-3-nitrobenzoyl)amino]phenoxy]phthalic acid |
|---|---|
| PubChem CID | 18506214 |
| Molecular Formula | C21H13ClN2O8 |
| Molecular Weight | 456.79 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | 4-[2-[(4-chloro-3-nitrobenzoyl)amino]phenoxy]phthalic acid |
| SMILES | O=C(Nc1ccccc1Oc1ccc(C(=O)O)c(C(=O)O)c1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H13ClN2O8/c22-15-8-5-11(9-17(15)24(30)31)19(25)23-16-3-1-2-4-18(16)32-12-6-7-13(20(26)27)14(10-12)21(28)29/h1-10H,(H,23,25)(H,26,27)(H,28,29) |
| InChIKey | CFNUUEVIEUIVFH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 156.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.79 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|