C22H15NO8 — CID 18506111
4-[2-[(2-carboxybenzoyl)amino]phenoxy]phthalic acid (PubChem CID 18506111) has the molecular formula C22H15NO8 and a molecular weight of 421.36 g/mol. Its IUPAC name is 4-[2-[(2-carboxybenzoyl)amino]phenoxy]phthalic acid.
| Compound Name | 4-[2-[(2-carboxybenzoyl)amino]phenoxy]phthalic acid |
|---|---|
| PubChem CID | 18506111 |
| Molecular Formula | C22H15NO8 |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 4-[2-[(2-carboxybenzoyl)amino]phenoxy]phthalic acid |
| SMILES | O=C(O)c1ccc(Oc2ccccc2NC(=O)c2ccccc2C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C22H15NO8/c24-19(13-5-1-2-6-14(13)20(25)26)23-17-7-3-4-8-18(17)31-12-9-10-15(21(27)28)16(11-12)22(29)30/h1-11H,(H,23,24)(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | NQJSEKCYMNZBNI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |