C21H13NO6-2 — CID 7232593
4-[(2-phenoxyphenyl)carbamoyl]benzene-1,3-dicarboxylate (PubChem CID 7232593) has the molecular formula C21H13NO6-2 and a molecular weight of 375.34 g/mol. Its IUPAC name is 4-[(2-phenoxyphenyl)carbamoyl]benzene-1,3-dicarboxylate.
| Compound Name | 4-[(2-phenoxyphenyl)carbamoyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 7232593 |
| Molecular Formula | C21H13NO6-2 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 4-[(2-phenoxyphenyl)carbamoyl]benzene-1,3-dicarboxylate |
| SMILES | O=C([O-])c1ccc(C(=O)Nc2ccccc2Oc2ccccc2)c(C(=O)[O-])c1 |
| InChI | InChI=1S/C21H15NO6/c23-19(15-11-10-13(20(24)25)12-16(15)21(26)27)22-17-8-4-5-9-18(17)28-14-6-2-1-3-7-14/h1-12H,(H,22,23)(H,24,25)(H,26,27)/p-2 |
| InChIKey | RDSWHBPKNNIZOG-UHFFFAOYSA-L |
| XLogP | 1.46 |
| TPSA | 118.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |