C22H21NO2 — CID 100710300
2,4,5-trimethyl-N-(2-phenoxyphenyl)benzamide (PubChem CID 100710300) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 2,4,5-trimethyl-N-(2-phenoxyphenyl)benzamide.
| Compound Name | 2,4,5-trimethyl-N-(2-phenoxyphenyl)benzamide |
|---|---|
| PubChem CID | 100710300 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2,4,5-trimethyl-N-(2-phenoxyphenyl)benzamide |
| SMILES | Cc1cc(C)c(C(=O)Nc2ccccc2Oc2ccccc2)cc1C |
| InChI | InChI=1S/C22H21NO2/c1-15-13-17(3)19(14-16(15)2)22(24)23-20-11-7-8-12-21(20)25-18-9-5-4-6-10-18/h4-14H,1-3H3,(H,23,24) |
| InChIKey | MGALVRZFVWTXST-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |